C44H63N5O10 — CID 159520565
2-(benzylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylmethoxycarbonylamino)ethyl 2-methylbutanoate (PubChem CID 159520565) has the molecular formula C44H63N5O10 and a molecular weight of 822.01 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylmethoxycarbonylamino)ethyl 2-methylbutanoate.
| Compound Name | 2-(benzylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylmethoxycarbonylamino)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 159520565 |
| Molecular Formula | C44H63N5O10 |
| Molecular Weight | 822.01 g/mol |
| Exact Mass | 821.46 |
| IUPAC Name | 2-(benzylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylcarbamoylamino)ethyl 2-methylbutanoate;2-(phenylmethoxycarbonylamino)ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCNC(=O)NCc1ccccc1.CCC(C)C(=O)OCCNC(=O)Nc1ccccc1.CCC(C)C(=O)OCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O3.C15H21NO4.C14H20N2O3/c1-3-12(2)14(18)20-10-9-16-15(19)17-11-13-7-5-4-6-8-13;1-3-12(2)14(17)19-10-9-16-15(18)20-11-13-7-5-4-6-8-13;1-3-11(2)13(17)19-10-9-15-14(18)16-12-7-5-4-6-8-12/h4-8,12H,3,9-11H2,1-2H3,(H2,16,17,19);4-8,12H,3,9-11H2,1-2H3,(H,16,18);4-8,11H,3,9-10H2,1-2H3,(H2,15,16,18) |
| InChIKey | MBTAJAUNRNPDKO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 199.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.01 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|