C19H42O2Si5 — CID 123576724
bis[[2-dimethylsilylethyl(dimethyl)silyl]oxy]-methyl-phenylsilane (PubChem CID 123576724) has the molecular formula C19H42O2Si5 and a molecular weight of 442.97 g/mol. Its IUPAC name is bis[[2-dimethylsilylethyl(dimethyl)silyl]oxy]-methyl-phenylsilane.
| Compound Name | bis[[2-dimethylsilylethyl(dimethyl)silyl]oxy]-methyl-phenylsilane |
|---|---|
| PubChem CID | 123576724 |
| Molecular Formula | C19H42O2Si5 |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | bis[[2-dimethylsilylethyl(dimethyl)silyl]oxy]-methyl-phenylsilane |
| SMILES | C[SiH](C)CC[Si](C)(C)O[Si](C)(O[Si](C)(C)CC[SiH](C)C)c1ccccc1 |
| InChI | InChI=1S/C19H42O2Si5/c1-22(2)15-17-24(5,6)20-26(9,19-13-11-10-12-14-19)21-25(7,8)18-16-23(3)4/h10-14,22-23H,15-18H2,1-9H3 |
| InChIKey | IJWWCWZSQQUTJS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|