C15H34O4Si5 — CID 150218569
[benzyl-[dimethylsilyloxy(dimethyl)silyl]oxysilyl]oxy-dimethylsilyloxy-dimethylsilane (PubChem CID 150218569) has the molecular formula C15H34O4Si5 and a molecular weight of 418.86 g/mol. Its IUPAC name is [benzyl-[dimethylsilyloxy(dimethyl)silyl]oxysilyl]oxy-dimethylsilyloxy-dimethylsilane.
| Compound Name | [benzyl-[dimethylsilyloxy(dimethyl)silyl]oxysilyl]oxy-dimethylsilyloxy-dimethylsilane |
|---|---|
| PubChem CID | 150218569 |
| Molecular Formula | C15H34O4Si5 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [benzyl-[dimethylsilyloxy(dimethyl)silyl]oxysilyl]oxy-dimethylsilyloxy-dimethylsilane |
| SMILES | C[SiH](C)O[Si](C)(C)O[SiH](Cc1ccccc1)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C15H34O4Si5/c1-20(2)16-23(5,6)18-22(14-15-12-10-9-11-13-15)19-24(7,8)17-21(3)4/h9-13,20-22H,14H2,1-8H3 |
| InChIKey | FSZOLYTVCYKTLS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|