About benzyl(silyloxy)silane;dimethyl(silyloxy)silane
benzyl(silyloxy)silane;dimethyl(silyloxy)silane (PubChem CID 173029516) has the molecular formula C9H22O2Si4
and a molecular weight of 274.62 g/mol. Its IUPAC name is benzyl(silyloxy)silane;dimethyl(silyloxy)silane.
Molecular Properties
| Compound Name | benzyl(silyloxy)silane;dimethyl(silyloxy)silane |
| PubChem CID | 173029516 |
| Molecular Formula | C9H22O2Si4 |
| Molecular Weight | 274.62 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | benzyl(silyloxy)silane;dimethyl(silyloxy)silane |
| SMILES | C[SiH](C)O[SiH3].[SiH3]O[SiH2]Cc1ccccc1 |
| InChI | InChI=1S/C7H12OSi2.C2H10OSi2/c9-8-10-6-7-4-2-1-3-5-7;1-5(2)3-4/h1-5H,6,10H2,9H3;5H,1-2,4H3 |
| InChIKey | YXBHMHITRKXZNJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.62 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl(silyloxy)silane;dimethyl(silyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(silyloxy)silane;dimethyl(silyloxy)silane?
The IUPAC name of benzyl(silyloxy)silane;dimethyl(silyloxy)silane (CID 173029516) is benzyl(silyloxy)silane;dimethyl(silyloxy)silane.
What is the SMILES notation for benzyl(silyloxy)silane;dimethyl(silyloxy)silane?
The canonical SMILES for benzyl(silyloxy)silane;dimethyl(silyloxy)silane is C[SiH](C)O[SiH3].[SiH3]O[SiH2]Cc1ccccc1.
What is the InChIKey of benzyl(silyloxy)silane;dimethyl(silyloxy)silane?
The InChIKey is YXBHMHITRKXZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OSi2.C2H10OSi2/c9-8-10-6-7-4-2-1-3-5-7;1-5(2)3-4/h1-5H,6,10H2,9H3;5H,1-2,4H3.
What are the key properties of benzyl(silyloxy)silane;dimethyl(silyloxy)silane?
benzyl(silyloxy)silane;dimethyl(silyloxy)silane has a molecular weight of 274.62 g/mol, XLogP of -1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(silyloxy)silane;dimethyl(silyloxy)silane is sourced from PubChem (CID 173029516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).