C6H21F3O2Si4 — CID 173022510
dimethyl(silyloxy)silane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane (PubChem CID 173022510) has the molecular formula C6H21F3O2Si4 and a molecular weight of 294.57 g/mol. Its IUPAC name is dimethyl(silyloxy)silane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl(silyloxy)silane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 173022510 |
| Molecular Formula | C6H21F3O2Si4 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | dimethyl(silyloxy)silane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane |
| SMILES | C[SiH](C)O[SiH3].C[SiH](CCC(F)(F)F)O[SiH3] |
| InChI | InChI=1S/C4H11F3OSi2.C2H10OSi2/c1-10(8-9)3-2-4(5,6)7;1-5(2)3-4/h10H,2-3H2,1,9H3;5H,1-2,4H3 |
| InChIKey | KYYMJWSCFJEXAN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|