C4H13F3Si3 — CID 123256686
methylsilyl-silyl-(3,3,3-trifluoropropyl)silane (PubChem CID 123256686) has the molecular formula C4H13F3Si3 and a molecular weight of 202.40 g/mol. Its IUPAC name is methylsilyl-silyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | methylsilyl-silyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123256686 |
| Molecular Formula | C4H13F3Si3 |
| Molecular Weight | 202.40 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | methylsilyl-silyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[SiH2][SiH]([SiH3])CCC(F)(F)F |
| InChI | InChI=1S/C4H13F3Si3/c1-9-10(8)3-2-4(5,6)7/h10H,2-3,9H2,1,8H3 |
| InChIKey | HWKVYKJMBDPWQV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|