C6H10F6Si — CID 123327459
bis(3,3,3-trifluoropropyl)silane (PubChem CID 123327459) has the molecular formula C6H10F6Si and a molecular weight of 224.22 g/mol. Its IUPAC name is bis(3,3,3-trifluoropropyl)silane.
| Compound Name | bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123327459 |
| Molecular Formula | C6H10F6Si |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | bis(3,3,3-trifluoropropyl)silane |
| SMILES | FC(F)(F)CC[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C6H10F6Si/c7-5(8,9)1-3-13-4-2-6(10,11)12/h1-4,13H2 |
| InChIKey | NKMACFYHIUKZHK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|