C8H25F3O4Si5 — CID 158099472
dimethyl-[methyl-[methyl-[methyl(3,3,3-trifluoropropylsilyloxy)silyl]oxysilyl]oxysilyl]oxysilane (PubChem CID 158099472) has the molecular formula C8H25F3O4Si5 and a molecular weight of 382.71 g/mol. Its IUPAC name is dimethyl-[methyl-[methyl-[methyl(3,3,3-trifluoropropylsilyloxy)silyl]oxysilyl]oxysilyl]oxysilane.
| Compound Name | dimethyl-[methyl-[methyl-[methyl(3,3,3-trifluoropropylsilyloxy)silyl]oxysilyl]oxysilyl]oxysilane |
|---|---|
| PubChem CID | 158099472 |
| Molecular Formula | C8H25F3O4Si5 |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | dimethyl-[methyl-[methyl-[methyl(3,3,3-trifluoropropylsilyloxy)silyl]oxysilyl]oxysilyl]oxysilane |
| SMILES | C[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C8H25F3O4Si5/c1-17(2)13-19(4)15-20(5)14-18(3)12-16-7-6-8(9,10)11/h17-20H,6-7,16H2,1-5H3 |
| InChIKey | FPBVBPRRXAHKFI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|