C12H23F3O3Si2 — CID 123513467
2-[dimethyl(3,3,3-trifluoropropylsilyloxy)silyl]propan-2-yl 2-methylprop-2-enoate (PubChem CID 123513467) has the molecular formula C12H23F3O3Si2 and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-[dimethyl(3,3,3-trifluoropropylsilyloxy)silyl]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-[dimethyl(3,3,3-trifluoropropylsilyloxy)silyl]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123513467 |
| Molecular Formula | C12H23F3O3Si2 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[dimethyl(3,3,3-trifluoropropylsilyloxy)silyl]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)[Si](C)(C)O[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C12H23F3O3Si2/c1-9(2)10(16)17-11(3,4)20(5,6)18-19-8-7-12(13,14)15/h1,7-8,19H2,2-6H3 |
| InChIKey | FIIAKCGPPSNLSJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|