C13H17F7O2 — CID 90253905
[1,1,1,2-tetrafluoro-4-methyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate (PubChem CID 90253905) has the molecular formula C13H17F7O2 and a molecular weight of 338.26 g/mol. Its IUPAC name is [1,1,1,2-tetrafluoro-4-methyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,2-tetrafluoro-4-methyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90253905 |
| Molecular Formula | C13H17F7O2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [1,1,1,2-tetrafluoro-4-methyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H17F7O2/c1-5-6-10(4,22-9(21)8(2)3)7-11(14,12(15,16)17)13(18,19)20/h2,5-7H2,1,3-4H3 |
| InChIKey | PTBQGZOBONGUGG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|