C3H9F3O3Si2 — CID 175158719
hydroxy-hydroxysilyloxy-(3,3,3-trifluoropropyl)silane (PubChem CID 175158719) has the molecular formula C3H9F3O3Si2 and a molecular weight of 206.27 g/mol. Its IUPAC name is hydroxy-hydroxysilyloxy-(3,3,3-trifluoropropyl)silane.
| Compound Name | hydroxy-hydroxysilyloxy-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 175158719 |
| Molecular Formula | C3H9F3O3Si2 |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | hydroxy-hydroxysilyloxy-(3,3,3-trifluoropropyl)silane |
| SMILES | O[SiH2]O[SiH](O)CCC(F)(F)F |
| InChI | InChI=1S/C3H9F3O3Si2/c4-3(5,6)1-2-11(8)9-10-7/h7-8,11H,1-2,10H2 |
| InChIKey | KHZVJNJWDDVVBW-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|