C7H11ClF6Si — CID 123967861
chloromethyl-bis(3,3,3-trifluoropropyl)silane (PubChem CID 123967861) has the molecular formula C7H11ClF6Si and a molecular weight of 272.69 g/mol. Its IUPAC name is chloromethyl-bis(3,3,3-trifluoropropyl)silane.
| Compound Name | chloromethyl-bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123967861 |
| Molecular Formula | C7H11ClF6Si |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | chloromethyl-bis(3,3,3-trifluoropropyl)silane |
| SMILES | FC(F)(F)CC[SiH](CCl)CCC(F)(F)F |
| InChI | InChI=1S/C7H11ClF6Si/c8-5-15(3-1-6(9,10)11)4-2-7(12,13)14/h15H,1-5H2 |
| InChIKey | WJSBSXQTCVEZHH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|