C7H9F9O2Si — CID 123609783
bis(1,2,2-trifluoroethoxy)-(3,3,3-trifluoropropyl)silane (PubChem CID 123609783) has the molecular formula C7H9F9O2Si and a molecular weight of 324.22 g/mol. Its IUPAC name is bis(1,2,2-trifluoroethoxy)-(3,3,3-trifluoropropyl)silane.
| Compound Name | bis(1,2,2-trifluoroethoxy)-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123609783 |
| Molecular Formula | C7H9F9O2Si |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | bis(1,2,2-trifluoroethoxy)-(3,3,3-trifluoropropyl)silane |
| SMILES | FC(F)C(F)O[SiH](CCC(F)(F)F)OC(F)C(F)F |
| InChI | InChI=1S/C7H9F9O2Si/c8-3(9)5(12)17-19(2-1-7(14,15)16)18-6(13)4(10)11/h3-6,19H,1-2H2 |
| InChIKey | LXFOXMUGSDFPAM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|