C3H11F3Si3 — CID 123648893
disilyl(3,3,3-trifluoropropyl)silane (PubChem CID 123648893) has the molecular formula C3H11F3Si3 and a molecular weight of 188.37 g/mol. Its IUPAC name is disilyl(3,3,3-trifluoropropyl)silane.
| Compound Name | disilyl(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123648893 |
| Molecular Formula | C3H11F3Si3 |
| Molecular Weight | 188.37 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | disilyl(3,3,3-trifluoropropyl)silane |
| SMILES | FC(F)(F)CC[SiH]([SiH3])[SiH3] |
| InChI | InChI=1S/C3H11F3Si3/c4-3(5,6)1-2-9(7)8/h9H,1-2H2,7-8H3 |
| InChIKey | RHGPWKUUGFPFPE-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|