C9H29F3O3Si6 — CID 173262736
dimethylsilyloxysilyl-ethenyl-methyl-silyloxysilane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane (PubChem CID 173262736) has the molecular formula C9H29F3O3Si6 and a molecular weight of 410.84 g/mol. Its IUPAC name is dimethylsilyloxysilyl-ethenyl-methyl-silyloxysilane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethylsilyloxysilyl-ethenyl-methyl-silyloxysilane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 173262736 |
| Molecular Formula | C9H29F3O3Si6 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | dimethylsilyloxysilyl-ethenyl-methyl-silyloxysilane;methyl-silyloxy-(3,3,3-trifluoropropyl)silane |
| SMILES | C=C[Si](C)(O[SiH3])[SiH2]O[SiH](C)C.C[SiH](CCC(F)(F)F)O[SiH3] |
| InChI | InChI=1S/C5H18O2Si4.C4H11F3OSi2/c1-5-11(4,6-8)9-7-10(2)3;1-10(8-9)3-2-4(5,6)7/h5,10H,1,9H2,2-4,8H3;10H,2-3H2,1,9H3 |
| InChIKey | JHQVCOQELMIEJI-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|