C7H9F9OSi — CID 173374467
methoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane (PubChem CID 173374467) has the molecular formula C7H9F9OSi and a molecular weight of 308.22 g/mol. Its IUPAC name is methoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane.
| Compound Name | methoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 173374467 |
| Molecular Formula | C7H9F9OSi |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | methoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
| SMILES | CO[SiH2]C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C7H9F9OSi/c1-17-18-7(15,16)6(13,14)4(8,9)2-3-5(10,11)12/h2-3,18H2,1H3 |
| InChIKey | PKYKDVZWMICBGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|