C12H8Cl2F18Si — CID 53431090
dichloro-bis(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane (PubChem CID 53431090) has the molecular formula C12H8Cl2F18Si and a molecular weight of 593.15 g/mol. Its IUPAC name is dichloro-bis(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane.
| Compound Name | dichloro-bis(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 53431090 |
| Molecular Formula | C12H8Cl2F18Si |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | dichloro-bis(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
| SMILES | FC(F)(F)CCC(F)(F)C(F)(F)C(F)(F)[Si](Cl)(Cl)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C12H8Cl2F18Si/c13-33(14,11(29,30)9(25,26)5(15,16)1-3-7(19,20)21)12(31,32)10(27,28)6(17,18)2-4-8(22,23)24/h1-4H2 |
| InChIKey | MIZYXWOLOKZZFU-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|