About carbanide;chromium;trimethylsilane
carbanide;chromium;trimethylsilane (PubChem CID 174258936) has the molecular formula C4H13CrSi-
and a molecular weight of 141.23 g/mol. Its IUPAC name is carbanide;chromium;trimethylsilane.
Molecular Properties
| Compound Name | carbanide;chromium;trimethylsilane |
| PubChem CID | 174258936 |
| Molecular Formula | C4H13CrSi- |
| Molecular Weight | 141.23 g/mol |
| Exact Mass | 141.02 |
| IUPAC Name | carbanide;chromium;trimethylsilane |
| SMILES | C[SiH](C)C.[CH3-].[Cr] |
| InChI | InChI=1S/C3H10Si.CH3.Cr/c1-4(2)3;;/h4H,1-3H3;1H3;/q;-1; |
| InChIKey | ALLYBPLRBOBUJT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chromium;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chromium;trimethylsilane?
The IUPAC name of carbanide;chromium;trimethylsilane (CID 174258936) is carbanide;chromium;trimethylsilane.
What is the SMILES notation for carbanide;chromium;trimethylsilane?
The canonical SMILES for carbanide;chromium;trimethylsilane is C[SiH](C)C.[CH3-].[Cr].
What is the InChIKey of carbanide;chromium;trimethylsilane?
The InChIKey is ALLYBPLRBOBUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.CH3.Cr/c1-4(2)3;;/h4H,1-3H3;1H3;/q;-1;.
What are the key properties of carbanide;chromium;trimethylsilane?
carbanide;chromium;trimethylsilane has a molecular weight of 141.23 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chromium;trimethylsilane is sourced from PubChem (CID 174258936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).