About chloro(dimethyl)silane;chloromethane
chloro(dimethyl)silane;chloromethane (PubChem CID 173366614) has the molecular formula C3H10Cl2Si
and a molecular weight of 145.10 g/mol. Its IUPAC name is chloro(dimethyl)silane;chloromethane.
Molecular Properties
| Compound Name | chloro(dimethyl)silane;chloromethane |
| PubChem CID | 173366614 |
| Molecular Formula | C3H10Cl2Si |
| Molecular Weight | 145.10 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | chloro(dimethyl)silane;chloromethane |
| SMILES | CCl.C[SiH](C)Cl |
| InChI | InChI=1S/C2H7ClSi.CH3Cl/c1-4(2)3;1-2/h4H,1-2H3;1H3 |
| InChIKey | SKVMBTFAZDVKAO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(dimethyl)silane;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dimethyl)silane;chloromethane?
The IUPAC name of chloro(dimethyl)silane;chloromethane (CID 173366614) is chloro(dimethyl)silane;chloromethane.
What is the SMILES notation for chloro(dimethyl)silane;chloromethane?
The canonical SMILES for chloro(dimethyl)silane;chloromethane is CCl.C[SiH](C)Cl.
What is the InChIKey of chloro(dimethyl)silane;chloromethane?
The InChIKey is SKVMBTFAZDVKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7ClSi.CH3Cl/c1-4(2)3;1-2/h4H,1-2H3;1H3.
What are the key properties of chloro(dimethyl)silane;chloromethane?
chloro(dimethyl)silane;chloromethane has a molecular weight of 145.10 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dimethyl)silane;chloromethane is sourced from PubChem (CID 173366614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).