C8H28O4Si5 — CID 157123096
2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane;methyl(methylsilyloxy)silane (PubChem CID 157123096) has the molecular formula C8H28O4Si5 and a molecular weight of 328.74 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane;methyl(methylsilyloxy)silane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane;methyl(methylsilyloxy)silane |
|---|---|
| PubChem CID | 157123096 |
| Molecular Formula | C8H28O4Si5 |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane;methyl(methylsilyloxy)silane |
| SMILES | C[SiH2]O[SiH2]C.C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C6H18O3Si3.C2H10OSi2/c1-10(2)7-11(3,4)9-12(5,6)8-10;1-4-3-5-2/h1-6H3;4-5H2,1-2H3 |
| InChIKey | AIEYTWOCIXGNSE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|