C28H84O20Si17 — CID 18967232
tetrakis(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) silicate (PubChem CID 18967232) has the molecular formula C28H84O20Si17 and a molecular weight of 1218.42 g/mol. Its IUPAC name is tetrakis(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) silicate.
| Compound Name | tetrakis(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) silicate |
|---|---|
| PubChem CID | 18967232 |
| Molecular Formula | C28H84O20Si17 |
| Molecular Weight | 1218.42 g/mol |
| Exact Mass | 1216.16 |
| IUPAC Name | tetrakis(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) silicate |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(O[Si](O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)(O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C28H84O20Si17/c1-49(2)29-53(9,10)37-61(25,38-54(11,12)30-49)45-65(46-62(26)39-55(13,14)31-50(3,4)32-56(15,16)40-62,47-63(27)41-57(17,18)33-51(5,6)34-58(19,20)42-63)48-64(28)43-59(21,22)35-52(7,8)36-60(23,24)44-64/h1-28H3 |
| InChIKey | SZGCPAZWOZCWKI-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1218.42 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|