C10H30O9Si6 — CID 160716775
(1R,3R,5R,7R)-3,5-dimethoxy-1,3,5,7,9,9,11,11-octamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane (PubChem CID 160716775) has the molecular formula C10H30O9Si6 and a molecular weight of 462.86 g/mol. Its IUPAC name is (1R,3R,5R,7R)-3,5-dimethoxy-1,3,5,7,9,9,11,11-octamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane.
| Compound Name | (1R,3R,5R,7R)-3,5-dimethoxy-1,3,5,7,9,9,11,11-octamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
|---|---|
| PubChem CID | 160716775 |
| Molecular Formula | C10H30O9Si6 |
| Molecular Weight | 462.86 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | (1R,3R,5R,7R)-3,5-dimethoxy-1,3,5,7,9,9,11,11-octamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
| SMILES | CO[Si@]1(C)O[Si@@](C)(OC)O[Si@@]2(C)O[Si](C)(C)O[Si](C)(C)O[Si@](C)(O1)O2 |
| InChI | InChI=1S/C10H30O9Si6/c1-11-22(7)16-23(8,12-2)18-25(10)15-21(5,6)13-20(3,4)14-24(9,17-22)19-25/h1-10H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | RSOMQAICICWDMK-ZGFBMJKBSA-N |
| XLogP | 2.10 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.86 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|