C10H30O7Si6 — CID 13425888
1,3,3,5,5,7,9,9,11,11-decamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane (PubChem CID 13425888) has the molecular formula C10H30O7Si6 and a molecular weight of 430.86 g/mol. Its IUPAC name is 1,3,3,5,5,7,9,9,11,11-decamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane.
| Compound Name | 1,3,3,5,5,7,9,9,11,11-decamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
|---|---|
| PubChem CID | 13425888 |
| Molecular Formula | C10H30O7Si6 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1,3,3,5,5,7,9,9,11,11-decamethyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(O1)O2 |
| InChI | InChI=1S/C10H30O7Si6/c1-18(2)11-19(3,4)14-23(10)16-21(7,8)12-20(5,6)15-22(9,13-18)17-23/h1-10H3 |
| InChIKey | CDELRGYYUZIUCS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|