C6H18O5Si4 — CID 102334800
1,3,3,5,5,7-hexamethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[5.1.1]nonane (PubChem CID 102334800) has the molecular formula C6H18O5Si4 and a molecular weight of 282.55 g/mol. Its IUPAC name is 1,3,3,5,5,7-hexamethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[5.1.1]nonane.
| Compound Name | 1,3,3,5,5,7-hexamethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[5.1.1]nonane |
|---|---|
| PubChem CID | 102334800 |
| Molecular Formula | C6H18O5Si4 |
| Molecular Weight | 282.55 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1,3,3,5,5,7-hexamethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[5.1.1]nonane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si]2(C)O[Si](C)(O1)O2 |
| InChI | InChI=1S/C6H18O5Si4/c1-12(2)7-13(3,4)9-15(6)10-14(5,8-12)11-15/h1-6H3 |
| InChIKey | OXXMOWROFBUFMD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|