C10H31NO5Si5 — CID 155623505
N,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine (PubChem CID 155623505) has the molecular formula C10H31NO5Si5 and a molecular weight of 385.79 g/mol. Its IUPAC name is N,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine.
| Compound Name | N,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine |
|---|---|
| PubChem CID | 155623505 |
| Molecular Formula | C10H31NO5Si5 |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine |
| SMILES | CN[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H31NO5Si5/c1-11-21(10)15-19(6,7)13-17(2,3)12-18(4,5)14-20(8,9)16-21/h11H,1-10H3 |
| InChIKey | LEWVXTIUDJCITI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|