C6H23NO5Si5 — CID 155623522
N,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine (PubChem CID 155623522) has the molecular formula C6H23NO5Si5 and a molecular weight of 329.68 g/mol. Its IUPAC name is N,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine.
| Compound Name | N,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine |
|---|---|
| PubChem CID | 155623522 |
| Molecular Formula | C6H23NO5Si5 |
| Molecular Weight | 329.68 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-amine |
| SMILES | CN[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C6H23NO5Si5/c1-7-17(6)11-15(4)9-13(2)8-14(3)10-16(5)12-17/h7,13-16H,1-6H3 |
| InChIKey | WMCTUCSJRLMTGO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.68 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|