C11H26O6Si4 — CID 69400493
(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) 2-methylprop-2-enoate (PubChem CID 69400493) has the molecular formula C11H26O6Si4 and a molecular weight of 366.67 g/mol. Its IUPAC name is (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69400493 |
| Molecular Formula | C11H26O6Si4 |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H26O6Si4/c1-10(2)11(12)13-21(9)16-19(5,6)14-18(3,4)15-20(7,8)17-21/h1H2,2-9H3 |
| InChIKey | BRVHFZAELSNPEF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|