C14H34O6Si4 — CID 172847333
2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;propyl 2-methylprop-2-enoate (PubChem CID 172847333) has the molecular formula C14H34O6Si4 and a molecular weight of 410.76 g/mol. Its IUPAC name is 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;propyl 2-methylprop-2-enoate.
| Compound Name | 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172847333 |
| Molecular Formula | C14H34O6Si4 |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.C[SiH]1O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C7H22O4Si4.C7H12O2/c1-12-8-13(2,3)10-15(6,7)11-14(4,5)9-12;1-4-5-9-7(8)6(2)3/h12H,1-7H3;2,4-5H2,1,3H3 |
| InChIKey | XPGUANNRAVHMJG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|