C40H70O15Si5 — CID 20588104
3-[2,4,6,8,10-pentamethyl-4,6,8,10-tetrakis[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propyl 2-methylprop-2-enoate (PubChem CID 20588104) has the molecular formula C40H70O15Si5 and a molecular weight of 931.41 g/mol. Its IUPAC name is 3-[2,4,6,8,10-pentamethyl-4,6,8,10-tetrakis[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2,4,6,8,10-pentamethyl-4,6,8,10-tetrakis[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20588104 |
| Molecular Formula | C40H70O15Si5 |
| Molecular Weight | 931.41 g/mol |
| Exact Mass | 930.36 |
| IUPAC Name | 3-[2,4,6,8,10-pentamethyl-4,6,8,10-tetrakis[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si]1(C)O[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(CCCOC(=O)C(=C)C)O1 |
| InChI | InChI=1S/C40H70O15Si5/c1-31(2)36(41)46-21-16-26-56(11)51-57(12,27-17-22-47-37(42)32(3)4)53-59(14,29-19-24-49-39(44)34(7)8)55-60(15,30-20-25-50-40(45)35(9)10)54-58(13,52-56)28-18-23-48-38(43)33(5)6/h1,3,5,7,9,16-30H2,2,4,6,8,10-15H3 |
| InChIKey | AIRANNGFEIEPGB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.41 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|