C32H56O12Si4 — CID 22590275
3-[2,4,6,8-tetramethyl-4,6,8-tris[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl 2-methylprop-2-enoate (PubChem CID 22590275) has the molecular formula C32H56O12Si4 and a molecular weight of 745.13 g/mol. Its IUPAC name is 3-[2,4,6,8-tetramethyl-4,6,8-tris[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2,4,6,8-tetramethyl-4,6,8-tris[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22590275 |
| Molecular Formula | C32H56O12Si4 |
| Molecular Weight | 745.13 g/mol |
| Exact Mass | 744.28 |
| IUPAC Name | 3-[2,4,6,8-tetramethyl-4,6,8-tris[3-(2-methylprop-2-enoyloxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si]1(C)O[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(CCCOC(=O)C(=C)C)O1 |
| InChI | InChI=1S/C32H56O12Si4/c1-25(2)29(33)37-17-13-21-45(9)41-46(10,22-14-18-38-30(34)26(3)4)43-48(12,24-16-20-40-32(36)28(7)8)44-47(11,42-45)23-15-19-39-31(35)27(5)6/h1,3,5,7,13-24H2,2,4,6,8-12H3 |
| InChIKey | BSUWHQDKSFHJPE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.13 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|