C15H34O6Si4 — CID 151722672
4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butyl 2-methylprop-2-enoate (PubChem CID 151722672) has the molecular formula C15H34O6Si4 and a molecular weight of 422.78 g/mol. Its IUPAC name is 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butyl 2-methylprop-2-enoate.
| Compound Name | 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151722672 |
| Molecular Formula | C15H34O6Si4 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C15H34O6Si4/c1-14(2)15(16)17-12-10-11-13-25(9)20-23(5,6)18-22(3,4)19-24(7,8)21-25/h1,10-13H2,2-9H3 |
| InChIKey | RIXILMQBMXMSIS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|