About N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate
N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate (PubChem CID 172705109) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate |
| PubChem CID | 172705109 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.CCN(C)CC |
| InChI | InChI=1S/C7H12O2.C5H13N/c1-4-5-9-7(8)6(2)3;1-4-6(3)5-2/h2,4-5H2,1,3H3;4-5H2,1-3H3 |
| InChIKey | DMBSOPMFOBQPDW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate?
The IUPAC name of N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate (CID 172705109) is N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate.
What is the SMILES notation for N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate?
The canonical SMILES for N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC.CCN(C)CC.
What is the InChIKey of N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate?
The InChIKey is DMBSOPMFOBQPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C5H13N/c1-4-5-9-7(8)6(2)3;1-4-6(3)5-2/h2,4-5H2,1,3H3;4-5H2,1-3H3.
What are the key properties of N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate?
N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate has a molecular weight of 215.34 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylethanamine;propyl 2-methylprop-2-enoate is sourced from PubChem (CID 172705109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).