C11H24O4Si — CID 158202415
ethyl(dimethoxy)silane;propyl 2-methylprop-2-enoate (PubChem CID 158202415) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is ethyl(dimethoxy)silane;propyl 2-methylprop-2-enoate.
| Compound Name | ethyl(dimethoxy)silane;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158202415 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl(dimethoxy)silane;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.CC[SiH](OC)OC |
| InChI | InChI=1S/C7H12O2.C4H12O2Si/c1-4-5-9-7(8)6(2)3;1-4-7(5-2)6-3/h2,4-5H2,1,3H3;7H,4H2,1-3H3 |
| InChIKey | GBCGKPMLUBLAJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|