About [hydroxy(methyl)silyl] 2-methylprop-2-enoate
[hydroxy(methyl)silyl] 2-methylprop-2-enoate (PubChem CID 173415248) has the molecular formula C5H10O3Si
and a molecular weight of 146.22 g/mol. Its IUPAC name is [hydroxy(methyl)silyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [hydroxy(methyl)silyl] 2-methylprop-2-enoate |
| PubChem CID | 173415248 |
| Molecular Formula | C5H10O3Si |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | [hydroxy(methyl)silyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[SiH](C)O |
| InChI | InChI=1S/C5H10O3Si/c1-4(2)5(6)8-9(3)7/h7,9H,1H2,2-3H3 |
| InChIKey | IQRZLBCBVYGYFB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy(methyl)silyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy(methyl)silyl] 2-methylprop-2-enoate?
The IUPAC name of [hydroxy(methyl)silyl] 2-methylprop-2-enoate (CID 173415248) is [hydroxy(methyl)silyl] 2-methylprop-2-enoate.
What is the SMILES notation for [hydroxy(methyl)silyl] 2-methylprop-2-enoate?
The canonical SMILES for [hydroxy(methyl)silyl] 2-methylprop-2-enoate is C=C(C)C(=O)O[SiH](C)O.
What is the InChIKey of [hydroxy(methyl)silyl] 2-methylprop-2-enoate?
The InChIKey is IQRZLBCBVYGYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3Si/c1-4(2)5(6)8-9(3)7/h7,9H,1H2,2-3H3.
What are the key properties of [hydroxy(methyl)silyl] 2-methylprop-2-enoate?
[hydroxy(methyl)silyl] 2-methylprop-2-enoate has a molecular weight of 146.22 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy(methyl)silyl] 2-methylprop-2-enoate is sourced from PubChem (CID 173415248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).