C11H31NO4Si4 — CID 140893224
N,N-diethyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 140893224) has the molecular formula C11H31NO4Si4 and a molecular weight of 353.72 g/mol. Its IUPAC name is N,N-diethyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N,N-diethyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 140893224 |
| Molecular Formula | C11H31NO4Si4 |
| Molecular Weight | 353.72 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N,N-diethyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | CCN(CC)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H31NO4Si4/c1-10-12(11-2)20(9)15-18(5,6)13-17(3,4)14-19(7,8)16-20/h10-11H2,1-9H3 |
| InChIKey | MYULOUNVWZGCEP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|