C15H39N3O3Si3 — CID 68656819
2-N,2-N,4-N,4-N,6-N,6-N-hexaethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4,6-triamine (PubChem CID 68656819) has the molecular formula C15H39N3O3Si3 and a molecular weight of 393.75 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexaethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexaethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4,6-triamine |
|---|---|
| PubChem CID | 68656819 |
| Molecular Formula | C15H39N3O3Si3 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexaethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4,6-triamine |
| SMILES | CCN(CC)[Si]1(C)O[Si](C)(N(CC)CC)O[Si](C)(N(CC)CC)O1 |
| InChI | InChI=1S/C15H39N3O3Si3/c1-10-16(11-2)22(7)19-23(8,17(12-3)13-4)21-24(9,20-22)18(14-5)15-6/h10-15H2,1-9H3 |
| InChIKey | YLSVBSLADRDJTB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|