C14H38N2O6Si4 — CID 18541971
N-[[2-(diethylaminooxy)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine (PubChem CID 18541971) has the molecular formula C14H38N2O6Si4 and a molecular weight of 442.81 g/mol. Its IUPAC name is N-[[2-(diethylaminooxy)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine.
| Compound Name | N-[[2-(diethylaminooxy)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 18541971 |
| Molecular Formula | C14H38N2O6Si4 |
| Molecular Weight | 442.81 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[[2-(diethylaminooxy)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine |
| SMILES | CCN(CC)O[Si]1(ON(CC)CC)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C14H38N2O6Si4/c1-11-15(12-2)17-26(18-16(13-3)14-4)21-24(7,8)19-23(5,6)20-25(9,10)22-26/h11-14H2,1-10H3 |
| InChIKey | LXUDRQBMFVSERF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|