C10H26O5Si3 — CID 150863384
2-(diethoxymethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 150863384) has the molecular formula C10H26O5Si3 and a molecular weight of 310.57 g/mol. Its IUPAC name is 2-(diethoxymethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-(diethoxymethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 150863384 |
| Molecular Formula | C10H26O5Si3 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(diethoxymethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CCOC(OCC)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H26O5Si3/c1-8-11-10(12-9-2)18(7)14-16(3,4)13-17(5,6)15-18/h10H,8-9H2,1-7H3 |
| InChIKey | KSNOCQJGQAWRBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|