C9H26O5Si4 — CID 175481101
2-(1-ethoxypropyl)-2,4,4,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 175481101) has the molecular formula C9H26O5Si4 and a molecular weight of 326.65 g/mol. Its IUPAC name is 2-(1-ethoxypropyl)-2,4,4,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(1-ethoxypropyl)-2,4,4,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 175481101 |
| Molecular Formula | C9H26O5Si4 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(1-ethoxypropyl)-2,4,4,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCOC(CC)[Si]1(C)O[SiH2]O[SiH](C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C9H26O5Si4/c1-7-9(10-8-2)18(6)12-15-11-16(3)13-17(4,5)14-18/h9,16H,7-8,15H2,1-6H3 |
| InChIKey | FEZFKBQZHWFFFE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|