C36H72O6Si6 — CID 150632523
2,2,4-tri(cyclodecen-1-yl)-4,6,6,8,8,10-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 150632523) has the molecular formula C36H72O6Si6 and a molecular weight of 769.48 g/mol. Its IUPAC name is 2,2,4-tri(cyclodecen-1-yl)-4,6,6,8,8,10-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,2,4-tri(cyclodecen-1-yl)-4,6,6,8,8,10-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 150632523 |
| Molecular Formula | C36H72O6Si6 |
| Molecular Weight | 769.48 g/mol |
| Exact Mass | 768.39 |
| IUPAC Name | 2,2,4-tri(cyclodecen-1-yl)-4,6,6,8,8,10-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | C[SiH]1O[SiH2]O[Si](C2=CCCCCCCCC2)(C2=CCCCCCCCC2)O[Si](C)(C2=CCCCCCCCC2)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C36H72O6Si6/c1-44-37-43-38-48(35-30-24-18-12-8-13-19-25-31-35,36-32-26-20-14-9-15-21-27-33-36)42-47(6,41-46(4,5)40-45(2,3)39-44)34-28-22-16-10-7-11-17-23-29-34/h28,30,32,44H,7-27,29,31,33,43H2,1-6H3 |
| InChIKey | IYEOFKFPLAUQHD-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.48 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|