C10H29NO4Si4 — CID 175187862
N,N-diethyl-2,4,4,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 175187862) has the molecular formula C10H29NO4Si4 and a molecular weight of 339.69 g/mol. Its IUPAC name is N,N-diethyl-2,4,4,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N,N-diethyl-2,4,4,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 175187862 |
| Molecular Formula | C10H29NO4Si4 |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N,N-diethyl-2,4,4,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | CCN(CC)[Si]1(C)O[Si](C)(C)O[SiH](C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H29NO4Si4/c1-9-11(10-2)19(8)14-17(4,5)12-16(3)13-18(6,7)15-19/h16H,9-10H2,1-8H3 |
| InChIKey | NQEQOADGFSNNIX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|