C7H22O6Si4 — CID 157296418
2,4-dihydroxy-2,4,6,8-tetramethyl-6-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 157296418) has the molecular formula C7H22O6Si4 and a molecular weight of 314.59 g/mol. Its IUPAC name is 2,4-dihydroxy-2,4,6,8-tetramethyl-6-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4-dihydroxy-2,4,6,8-tetramethyl-6-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 157296418 |
| Molecular Formula | C7H22O6Si4 |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2,4-dihydroxy-2,4,6,8-tetramethyl-6-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[SiH](C)O[Si](C)(O)O[Si](C)(O)O1 |
| InChI | InChI=1S/C7H22O6Si4/c1-6-7-15(3)10-14(2)11-16(4,8)13-17(5,9)12-15/h8-9,14H,6-7H2,1-5H3 |
| InChIKey | JZYSPYAYCAUCFJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|