C4H14O5Si3 — CID 151998579
2,4-dihydroxy-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 151998579) has the molecular formula C4H14O5Si3 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2,4-dihydroxy-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4-dihydroxy-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 151998579 |
| Molecular Formula | C4H14O5Si3 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2,4-dihydroxy-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[Si]1(C)O[Si](C)(O)O[Si](C)(O)O1 |
| InChI | InChI=1S/C4H14O5Si3/c1-10(2)7-11(3,5)9-12(4,6)8-10/h5-6H,1-4H3 |
| InChIKey | UGEQNRIYBONGCP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|