C7H22O8Si4 — CID 69471592
2-butan-2-yl-2,4,4,6-tetrahydroxy-6,8,8-trimethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 69471592) has the molecular formula C7H22O8Si4 and a molecular weight of 346.59 g/mol. Its IUPAC name is 2-butan-2-yl-2,4,4,6-tetrahydroxy-6,8,8-trimethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-butan-2-yl-2,4,4,6-tetrahydroxy-6,8,8-trimethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 69471592 |
| Molecular Formula | C7H22O8Si4 |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-butan-2-yl-2,4,4,6-tetrahydroxy-6,8,8-trimethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC(C)[Si]1(O)O[Si](C)(C)O[Si](C)(O)O[Si](O)(O)O1 |
| InChI | InChI=1S/C7H22O8Si4/c1-6-7(2)18(9)13-16(3,4)12-17(5,8)14-19(10,11)15-18/h7-11H,6H2,1-5H3 |
| InChIKey | UBTNLWWUSRKFES-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|