About 2-methylbutan-1-ol;zirconium
2-methylbutan-1-ol;zirconium (PubChem CID 152608404) has the molecular formula C5H12OZr
and a molecular weight of 179.37 g/mol. Its IUPAC name is 2-methylbutan-1-ol;zirconium.
Molecular Properties
| Compound Name | 2-methylbutan-1-ol;zirconium |
| PubChem CID | 152608404 |
| Molecular Formula | C5H12OZr |
| Molecular Weight | 179.37 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 2-methylbutan-1-ol;zirconium |
| SMILES | CCC(C)CO.[Zr] |
| InChI | InChI=1S/C5H12O.Zr/c1-3-5(2)4-6;/h5-6H,3-4H2,1-2H3; |
| InChIKey | HHERVQDDYMSVST-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbutan-1-ol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-1-ol;zirconium?
The IUPAC name of 2-methylbutan-1-ol;zirconium (CID 152608404) is 2-methylbutan-1-ol;zirconium.
What is the SMILES notation for 2-methylbutan-1-ol;zirconium?
The canonical SMILES for 2-methylbutan-1-ol;zirconium is CCC(C)CO.[Zr].
What is the InChIKey of 2-methylbutan-1-ol;zirconium?
The InChIKey is HHERVQDDYMSVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.Zr/c1-3-5(2)4-6;/h5-6H,3-4H2,1-2H3;.
What are the key properties of 2-methylbutan-1-ol;zirconium?
2-methylbutan-1-ol;zirconium has a molecular weight of 179.37 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-1-ol;zirconium is sourced from PubChem (CID 152608404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).