C11H25NO3 — CID 90040731
(2S,3S)-2-amino-3-methylpentanoic acid;2-methylbutan-1-ol (PubChem CID 90040731) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methylpentanoic acid;2-methylbutan-1-ol.
| Compound Name | (2S,3S)-2-amino-3-methylpentanoic acid;2-methylbutan-1-ol |
|---|---|
| PubChem CID | 90040731 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid;2-methylbutan-1-ol |
| SMILES | CCC(C)CO.CC[C@H](C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2.C5H12O/c1-3-4(2)5(7)6(8)9;1-3-5(2)4-6/h4-5H,3,7H2,1-2H3,(H,8,9);5-6H,3-4H2,1-2H3/t4-,5-;/m0./s1 |
| InChIKey | UJICQIXHISXKBA-FHAQVOQBSA-N |
| XLogP | 1.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |