C12H27NO8 — CID 86617048
(2S,3S)-2-amino-3-methylpentanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol (PubChem CID 86617048) has the molecular formula C12H27NO8 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methylpentanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S)-2-amino-3-methylpentanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 86617048 |
| Molecular Formula | C12H27NO8 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| SMILES | CC[C@H](C)[C@H](N)C(=O)O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO2.C6H14O6/c1-3-4(2)5(7)6(8)9;7-1-3(9)5(11)6(12)4(10)2-8/h4-5H,3,7H2,1-2H3,(H,8,9);3-12H,1-2H2/t4-,5-;3-,4-,5-,6-/m01/s1 |
| InChIKey | QWGUZYUTQYVPAI-OUXXYQHMSA-N |
| XLogP | -3.14 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |