C14H24O2 — CID 66965840
2-methoxy-1,3-dimethylbenzene;2-methylbutan-1-ol (PubChem CID 66965840) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-methoxy-1,3-dimethylbenzene;2-methylbutan-1-ol.
| Compound Name | 2-methoxy-1,3-dimethylbenzene;2-methylbutan-1-ol |
|---|---|
| PubChem CID | 66965840 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-methoxy-1,3-dimethylbenzene;2-methylbutan-1-ol |
| SMILES | CCC(C)CO.COc1c(C)cccc1C |
| InChI | InChI=1S/C9H12O.C5H12O/c1-7-5-4-6-8(2)9(7)10-3;1-3-5(2)4-6/h4-6H,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | YVXOOTSLWDWOET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |