About ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane
ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane (PubChem CID 143611271) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane.
Molecular Properties
| Compound Name | ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane |
| PubChem CID | 143611271 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane |
| SMILES | CC.CC.CC(C)C.CCNc1cccc(C)c1OC |
| InChI | InChI=1S/C10H15NO.C4H10.2C2H6/c1-4-11-9-7-5-6-8(2)10(9)12-3;1-4(2)3;2*1-2/h5-7,11H,4H2,1-3H3;4H,1-3H3;2*1-2H3 |
| InChIKey | XCXQNKMAODKCBZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane?
The IUPAC name of ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane (CID 143611271) is ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane.
What is the SMILES notation for ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane?
The canonical SMILES for ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane is CC.CC.CC(C)C.CCNc1cccc(C)c1OC.
What is the InChIKey of ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane?
The InChIKey is XCXQNKMAODKCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C4H10.2C2H6/c1-4-11-9-7-5-6-8(2)10(9)12-3;1-4(2)3;2*1-2/h5-7,11H,4H2,1-3H3;4H,1-3H3;2*1-2H3.
What are the key properties of ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane?
ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane has a molecular weight of 283.50 g/mol, XLogP of 6.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-2-methoxy-3-methylaniline;2-methylpropane is sourced from PubChem (CID 143611271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).