C10H15NO3 — CID 19389311
3-(ethylamino)-2,6-dimethoxyphenol (PubChem CID 19389311) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(ethylamino)-2,6-dimethoxyphenol.
| Compound Name | 3-(ethylamino)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 19389311 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-(ethylamino)-2,6-dimethoxyphenol |
| SMILES | CCNc1ccc(OC)c(O)c1OC |
| InChI | InChI=1S/C10H15NO3/c1-4-11-7-5-6-8(13-2)9(12)10(7)14-3/h5-6,11-12H,4H2,1-3H3 |
| InChIKey | GNSBIKMHNOSSHM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|